About 2-ethylsulfinylbutanal
2-ethylsulfinylbutanal (PubChem CID 20521768) has the molecular formula C6H12O2S
and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-ethylsulfinylbutanal.
Molecular Properties
| Compound Name | 2-ethylsulfinylbutanal |
| PubChem CID | 20521768 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-ethylsulfinylbutanal |
| SMILES | CCC(C=O)S(=O)CC |
| InChI | InChI=1S/C6H12O2S/c1-3-6(5-7)9(8)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BSRAEIZDIMGFHW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfinylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfinylbutanal?
The IUPAC name of 2-ethylsulfinylbutanal (CID 20521768) is 2-ethylsulfinylbutanal.
What is the SMILES notation for 2-ethylsulfinylbutanal?
The canonical SMILES for 2-ethylsulfinylbutanal is CCC(C=O)S(=O)CC.
What is the InChIKey of 2-ethylsulfinylbutanal?
The InChIKey is BSRAEIZDIMGFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-3-6(5-7)9(8)4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-ethylsulfinylbutanal?
2-ethylsulfinylbutanal has a molecular weight of 148.23 g/mol, XLogP of 0.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfinylbutanal is sourced from PubChem (CID 20521768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).