About 2-(diethylamino)butanal
2-(diethylamino)butanal (PubChem CID 57012052) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-(diethylamino)butanal.
Molecular Properties
| Compound Name | 2-(diethylamino)butanal |
| PubChem CID | 57012052 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-(diethylamino)butanal |
| SMILES | CCC(C=O)N(CC)CC |
| InChI | InChI=1S/C8H17NO/c1-4-8(7-10)9(5-2)6-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | UJRMEIJVOPHCGQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)butanal?
The IUPAC name of 2-(diethylamino)butanal (CID 57012052) is 2-(diethylamino)butanal.
What is the SMILES notation for 2-(diethylamino)butanal?
The canonical SMILES for 2-(diethylamino)butanal is CCC(C=O)N(CC)CC.
What is the InChIKey of 2-(diethylamino)butanal?
The InChIKey is UJRMEIJVOPHCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-8(7-10)9(5-2)6-3/h7-8H,4-6H2,1-3H3.
What are the key properties of 2-(diethylamino)butanal?
2-(diethylamino)butanal has a molecular weight of 143.23 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)butanal is sourced from PubChem (CID 57012052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).