C21H42N4O2 — CID 87433535
(E)-4-(diethylamino)hex-2-enamide;(E)-4-(diethylamino)-2-methylhex-2-enamide (PubChem CID 87433535) has the molecular formula C21H42N4O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (E)-4-(diethylamino)hex-2-enamide;(E)-4-(diethylamino)-2-methylhex-2-enamide.
| Compound Name | (E)-4-(diethylamino)hex-2-enamide;(E)-4-(diethylamino)-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 87433535 |
| Molecular Formula | C21H42N4O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (E)-4-(diethylamino)hex-2-enamide;(E)-4-(diethylamino)-2-methylhex-2-enamide |
| SMILES | CCC(/C=C(\C)C(N)=O)N(CC)CC.CCC(/C=C/C(N)=O)N(CC)CC |
| InChI | InChI=1S/C11H22N2O.C10H20N2O/c1-5-10(13(6-2)7-3)8-9(4)11(12)14;1-4-9(7-8-10(11)13)12(5-2)6-3/h8,10H,5-7H2,1-4H3,(H2,12,14);7-9H,4-6H2,1-3H3,(H2,11,13)/b9-8+;8-7+ |
| InChIKey | NUAFBQUELJIUCE-ITFLXOGHSA-N |
| XLogP | 2.69 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|