C8H12N2O2 — CID 54037507
4-methylhepta-2,5-dienediamide (PubChem CID 54037507) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 4-methylhepta-2,5-dienediamide.
| Compound Name | 4-methylhepta-2,5-dienediamide |
|---|---|
| PubChem CID | 54037507 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4-methylhepta-2,5-dienediamide |
| SMILES | CC(C=CC(N)=O)C=CC(N)=O |
| InChI | InChI=1S/C8H12N2O2/c1-6(2-4-7(9)11)3-5-8(10)12/h2-6H,1H3,(H2,9,11)(H2,10,12) |
| InChIKey | LJZSJEIFXXKABY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|