C14H16N2O2 — CID 54086053
4-(3-methylphenyl)hepta-2,5-dienediamide (PubChem CID 54086053) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(3-methylphenyl)hepta-2,5-dienediamide.
| Compound Name | 4-(3-methylphenyl)hepta-2,5-dienediamide |
|---|---|
| PubChem CID | 54086053 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-(3-methylphenyl)hepta-2,5-dienediamide |
| SMILES | Cc1cccc(C(C=CC(N)=O)C=CC(N)=O)c1 |
| InChI | InChI=1S/C14H16N2O2/c1-10-3-2-4-12(9-10)11(5-7-13(15)17)6-8-14(16)18/h2-9,11H,1H3,(H2,15,17)(H2,16,18) |
| InChIKey | MQNPRZDCVMIKQS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|