C13H13ClN2O2 — CID 170877400
(2E,5E)-4-(3-chlorophenyl)hepta-2,5-dienediamide (PubChem CID 170877400) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is (2E,5E)-4-(3-chlorophenyl)hepta-2,5-dienediamide.
| Compound Name | (2E,5E)-4-(3-chlorophenyl)hepta-2,5-dienediamide |
|---|---|
| PubChem CID | 170877400 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (2E,5E)-4-(3-chlorophenyl)hepta-2,5-dienediamide |
| SMILES | NC(=O)/C=C/C(/C=C/C(N)=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H13ClN2O2/c14-11-3-1-2-10(8-11)9(4-6-12(15)17)5-7-13(16)18/h1-9H,(H2,15,17)(H2,16,18)/b6-4+,7-5+ |
| InChIKey | GMGZGGDDZXMZDV-YDFGWWAZSA-N |
| XLogP | 1.51 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|