About 3-hydroxyprop-2-enamide;hydrochloride
3-hydroxyprop-2-enamide;hydrochloride (PubChem CID 87220592) has the molecular formula C3H6ClNO2
and a molecular weight of 123.54 g/mol. Its IUPAC name is 3-hydroxyprop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | 3-hydroxyprop-2-enamide;hydrochloride |
| PubChem CID | 87220592 |
| Molecular Formula | C3H6ClNO2 |
| Molecular Weight | 123.54 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | 3-hydroxyprop-2-enamide;hydrochloride |
| SMILES | Cl.NC(=O)C=CO |
| InChI | InChI=1S/C3H5NO2.ClH/c4-3(6)1-2-5;/h1-2,5H,(H2,4,6);1H |
| InChIKey | OAADBTQZORIKQJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.54 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyprop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyprop-2-enamide;hydrochloride?
The IUPAC name of 3-hydroxyprop-2-enamide;hydrochloride (CID 87220592) is 3-hydroxyprop-2-enamide;hydrochloride.
What is the SMILES notation for 3-hydroxyprop-2-enamide;hydrochloride?
The canonical SMILES for 3-hydroxyprop-2-enamide;hydrochloride is Cl.NC(=O)C=CO.
What is the InChIKey of 3-hydroxyprop-2-enamide;hydrochloride?
The InChIKey is OAADBTQZORIKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.ClH/c4-3(6)1-2-5;/h1-2,5H,(H2,4,6);1H.
What are the key properties of 3-hydroxyprop-2-enamide;hydrochloride?
3-hydroxyprop-2-enamide;hydrochloride has a molecular weight of 123.54 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyprop-2-enamide;hydrochloride is sourced from PubChem (CID 87220592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).