C7H17NOS — CID 123112524
N,N-dimethyl-2-propan-2-ylsulfinylethanamine (PubChem CID 123112524) has the molecular formula C7H17NOS and a molecular weight of 163.29 g/mol. Its IUPAC name is N,N-dimethyl-2-propan-2-ylsulfinylethanamine.
| Compound Name | N,N-dimethyl-2-propan-2-ylsulfinylethanamine |
|---|---|
| PubChem CID | 123112524 |
| Molecular Formula | C7H17NOS |
| Molecular Weight | 163.29 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N,N-dimethyl-2-propan-2-ylsulfinylethanamine |
| SMILES | CC(C)S(=O)CCN(C)C |
| InChI | InChI=1S/C7H17NOS/c1-7(2)10(9)6-5-8(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | HRPDLVMTWPCZMA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |