C5H13NOS — CID 118967540
N,N-dimethylpropane-2-sulfinamide (PubChem CID 118967540) has the molecular formula C5H13NOS and a molecular weight of 135.23 g/mol. Its IUPAC name is N,N-dimethylpropane-2-sulfinamide.
| Compound Name | N,N-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118967540 |
| Molecular Formula | C5H13NOS |
| Molecular Weight | 135.23 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | N,N-dimethylpropane-2-sulfinamide |
| SMILES | CC(C)S(=O)N(C)C |
| InChI | InChI=1S/C5H13NOS/c1-5(2)8(7)6(3)4/h5H,1-4H3 |
| InChIKey | ORAWKZBPQHKDAT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |