C30H36N4O4S — CID 142802070
5-(2-formylthieno[3,2-b]pyridin-7-yl)oxy-N-hex-2-ynyl-2-methylindole-1-carboxamide;methanol;1-methylpyrrolidine (PubChem CID 142802070) has the molecular formula C30H36N4O4S and a molecular weight of 548.71 g/mol. Its IUPAC name is 5-(2-formylthieno[3,2-b]pyridin-7-yl)oxy-N-hex-2-ynyl-2-methylindole-1-carboxamide;methanol;1-methylpyrrolidine.
| Compound Name | 5-(2-formylthieno[3,2-b]pyridin-7-yl)oxy-N-hex-2-ynyl-2-methylindole-1-carboxamide;methanol;1-methylpyrrolidine |
|---|---|
| PubChem CID | 142802070 |
| Molecular Formula | C30H36N4O4S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 5-(2-formylthieno[3,2-b]pyridin-7-yl)oxy-N-hex-2-ynyl-2-methylindole-1-carboxamide;methanol;1-methylpyrrolidine |
| SMILES | CCCC#CCNC(=O)n1c(C)cc2cc(Oc3ccnc4cc(C=O)sc34)ccc21.CN1CCCC1.CO |
| InChI | InChI=1S/C24H21N3O3S.C5H11N.CH4O/c1-3-4-5-6-10-26-24(29)27-16(2)12-17-13-18(7-8-21(17)27)30-22-9-11-25-20-14-19(15-28)31-23(20)22;1-6-4-2-3-5-6;1-2/h7-9,11-15H,3-4,10H2,1-2H3,(H,26,29);2-5H2,1H3;2H,1H3 |
| InChIKey | ASDULBBQTQLOQI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|