C21H27N3O3S — CID 1428025
N-[2,5-dimethoxy-4-(2-phenylethylcarbamothioylamino)phenyl]-2-methylpropanamide (PubChem CID 1428025) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-(2-phenylethylcarbamothioylamino)phenyl]-2-methylpropanamide.
| Compound Name | N-[2,5-dimethoxy-4-(2-phenylethylcarbamothioylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1428025 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2,5-dimethoxy-4-(2-phenylethylcarbamothioylamino)phenyl]-2-methylpropanamide |
| SMILES | COc1cc(NC(=S)NCCc2ccccc2)c(OC)cc1NC(=O)C(C)C |
| InChI | InChI=1S/C21H27N3O3S/c1-14(2)20(25)23-16-12-19(27-4)17(13-18(16)26-3)24-21(28)22-11-10-15-8-6-5-7-9-15/h5-9,12-14H,10-11H2,1-4H3,(H,23,25)(H2,22,24,28) |
| InChIKey | ZHCLOTTWMZZBMH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|