C23H34N2O3 — CID 142804679
tert-butyl (2S)-2-[(methoxymethylamino)methyl]pyrrolidine-1-carboxylate;2-methylnaphthalene (PubChem CID 142804679) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(methoxymethylamino)methyl]pyrrolidine-1-carboxylate;2-methylnaphthalene.
| Compound Name | tert-butyl (2S)-2-[(methoxymethylamino)methyl]pyrrolidine-1-carboxylate;2-methylnaphthalene |
|---|---|
| PubChem CID | 142804679 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | tert-butyl (2S)-2-[(methoxymethylamino)methyl]pyrrolidine-1-carboxylate;2-methylnaphthalene |
| SMILES | COCNC[C@@H]1CCCN1C(=O)OC(C)(C)C.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H24N2O3.C11H10/c1-12(2,3)17-11(15)14-7-5-6-10(14)8-13-9-16-4;1-9-6-7-10-4-2-3-5-11(10)8-9/h10,13H,5-9H2,1-4H3;2-8H,1H3/t10-;/m0./s1 |
| InChIKey | YOIICWFZWJHCIF-PPHPATTJSA-N |
| XLogP | 4.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|