C32H35NO3S — CID 142806109
6-propan-2-yl-8-[3-[[2-(prop-1-en-2-ylsulfonylmethyl)phenyl]methoxy]phenyl]quinoline;prop-1-ene (PubChem CID 142806109) has the molecular formula C32H35NO3S and a molecular weight of 513.70 g/mol. Its IUPAC name is 6-propan-2-yl-8-[3-[[2-(prop-1-en-2-ylsulfonylmethyl)phenyl]methoxy]phenyl]quinoline;prop-1-ene.
| Compound Name | 6-propan-2-yl-8-[3-[[2-(prop-1-en-2-ylsulfonylmethyl)phenyl]methoxy]phenyl]quinoline;prop-1-ene |
|---|---|
| PubChem CID | 142806109 |
| Molecular Formula | C32H35NO3S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 6-propan-2-yl-8-[3-[[2-(prop-1-en-2-ylsulfonylmethyl)phenyl]methoxy]phenyl]quinoline;prop-1-ene |
| SMILES | C=C(C)S(=O)(=O)Cc1ccccc1COc1cccc(-c2cc(C(C)C)cc3cccnc23)c1.C=CC |
| InChI | InChI=1S/C29H29NO3S.C3H6/c1-20(2)26-15-23-12-8-14-30-29(23)28(17-26)22-11-7-13-27(16-22)33-18-24-9-5-6-10-25(24)19-34(31,32)21(3)4;1-3-2/h5-17,20H,3,18-19H2,1-2,4H3;3H,1H2,2H3 |
| InChIKey | NOIVLGYYQRFTGT-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|