C22H19N3OS3 — CID 142806346
2-(1-benzothiophene-3-carboximidoyl)-4-N-(2-methylsulfinylphenyl)sulfanylbenzene-1,4-diamine (PubChem CID 142806346) has the molecular formula C22H19N3OS3 and a molecular weight of 437.62 g/mol. Its IUPAC name is 2-(1-benzothiophene-3-carboximidoyl)-4-N-(2-methylsulfinylphenyl)sulfanylbenzene-1,4-diamine.
| Compound Name | 2-(1-benzothiophene-3-carboximidoyl)-4-N-(2-methylsulfinylphenyl)sulfanylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142806346 |
| Molecular Formula | C22H19N3OS3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-(1-benzothiophene-3-carboximidoyl)-4-N-(2-methylsulfinylphenyl)sulfanylbenzene-1,4-diamine |
| SMILES | [H]/N=C(/c1cc(NSc2ccccc2S(C)=O)ccc1N)c1csc2ccccc12 |
| InChI | InChI=1S/C22H19N3OS3/c1-29(26)21-9-5-4-8-20(21)28-25-14-10-11-18(23)16(12-14)22(24)17-13-27-19-7-3-2-6-15(17)19/h2-13,24-25H,23H2,1H3/b24-22- |
| InChIKey | DRPHEQQUTVQAPZ-GYHWCHFESA-N |
| XLogP | 5.76 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|