C13H16ClN3 — CID 142808414
2-chloroaniline;N,5-dimethylpyridin-2-amine (PubChem CID 142808414) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is 2-chloroaniline;N,5-dimethylpyridin-2-amine.
| Compound Name | 2-chloroaniline;N,5-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 142808414 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-chloroaniline;N,5-dimethylpyridin-2-amine |
| SMILES | CNc1ccc(C)cn1.Nc1ccccc1Cl |
| InChI | InChI=1S/C7H10N2.C6H6ClN/c1-6-3-4-7(8-2)9-5-6;7-5-3-1-2-4-6(5)8/h3-5H,1-2H3,(H,8,9);1-4H,8H2 |
| InChIKey | VXTFGGFLLYMDLH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|