C24H19BrO2 — CID 142808682
(4S,5S)-2-(4-bromophenyl)-4-hydroxy-5-methyl-3,4-diphenylcyclopent-2-en-1-one (PubChem CID 142808682) has the molecular formula C24H19BrO2 and a molecular weight of 419.32 g/mol. Its IUPAC name is (4S,5S)-2-(4-bromophenyl)-4-hydroxy-5-methyl-3,4-diphenylcyclopent-2-en-1-one.
| Compound Name | (4S,5S)-2-(4-bromophenyl)-4-hydroxy-5-methyl-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 142808682 |
| Molecular Formula | C24H19BrO2 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | (4S,5S)-2-(4-bromophenyl)-4-hydroxy-5-methyl-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | C[C@@H]1C(=O)C(c2ccc(Br)cc2)=C(c2ccccc2)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H19BrO2/c1-16-23(26)21(17-12-14-20(25)15-13-17)22(18-8-4-2-5-9-18)24(16,27)19-10-6-3-7-11-19/h2-16,27H,1H3/t16-,24+/m1/s1 |
| InChIKey | FZSAGFJSHRENPD-GYCJOSAFSA-N |
| XLogP | 5.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|