C22H30INO3 — CID 142809821
ethane;ethyl 4-(2-iodo-3-methylphenyl)-5-(1-methoxyethenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 142809821) has the molecular formula C22H30INO3 and a molecular weight of 483.39 g/mol. Its IUPAC name is ethane;ethyl 4-(2-iodo-3-methylphenyl)-5-(1-methoxyethenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethane;ethyl 4-(2-iodo-3-methylphenyl)-5-(1-methoxyethenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 142809821 |
| Molecular Formula | C22H30INO3 |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | ethane;ethyl 4-(2-iodo-3-methylphenyl)-5-(1-methoxyethenyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | C=C(OC)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccc(C)c1I.CC |
| InChI | InChI=1S/C20H24INO3.C2H6/c1-7-25-20(23)17-13(4)22-12(3)16(14(5)24-6)18(17)15-10-8-9-11(2)19(15)21;1-2/h8-10,18,22H,5,7H2,1-4,6H3;1-2H3 |
| InChIKey | LNYCMVZWGHQLSN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|