C21H28FN3OS — CID 142809938
(2Z,4E,5Z)-2-(4-fluorophenyl)-N-methyl-3-(methylamino)-4-[(E)-2-methyl-1-methylsulfanylbut-1-enyl]iminohepta-2,5-dienamide (PubChem CID 142809938) has the molecular formula C21H28FN3OS and a molecular weight of 389.54 g/mol. Its IUPAC name is (2Z,4E,5Z)-2-(4-fluorophenyl)-N-methyl-3-(methylamino)-4-[(E)-2-methyl-1-methylsulfanylbut-1-enyl]iminohepta-2,5-dienamide.
| Compound Name | (2Z,4E,5Z)-2-(4-fluorophenyl)-N-methyl-3-(methylamino)-4-[(E)-2-methyl-1-methylsulfanylbut-1-enyl]iminohepta-2,5-dienamide |
|---|---|
| PubChem CID | 142809938 |
| Molecular Formula | C21H28FN3OS |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2Z,4E,5Z)-2-(4-fluorophenyl)-N-methyl-3-(methylamino)-4-[(E)-2-methyl-1-methylsulfanylbut-1-enyl]iminohepta-2,5-dienamide |
| SMILES | C/C=C\C(=N/C(SC)=C(/C)CC)\C(NC)=C(\C(=O)NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FN3OS/c1-7-9-17(25-21(27-6)14(3)8-2)19(23-4)18(20(26)24-5)15-10-12-16(22)13-11-15/h7,9-13,23H,8H2,1-6H3,(H,24,26)/b9-7-,19-18-,21-14+,25-17+ |
| InChIKey | RZTFJWPEAFUVSZ-KSWGYWATSA-N |
| XLogP | 4.52 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|