C16H18FN3O3S — CID 142809941
(2Z,4E,5Z)-3-amino-2-(4-fluorophenyl)-4-(1-methylsulfonylethenylimino)hepta-2,5-dienamide (PubChem CID 142809941) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is (2Z,4E,5Z)-3-amino-2-(4-fluorophenyl)-4-(1-methylsulfonylethenylimino)hepta-2,5-dienamide.
| Compound Name | (2Z,4E,5Z)-3-amino-2-(4-fluorophenyl)-4-(1-methylsulfonylethenylimino)hepta-2,5-dienamide |
|---|---|
| PubChem CID | 142809941 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2Z,4E,5Z)-3-amino-2-(4-fluorophenyl)-4-(1-methylsulfonylethenylimino)hepta-2,5-dienamide |
| SMILES | C=C(/N=C(\C=C/C)C(/N)=C(/C(N)=O)c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H18FN3O3S/c1-4-5-13(20-10(2)24(3,22)23)15(18)14(16(19)21)11-6-8-12(17)9-7-11/h4-9H,2,18H2,1,3H3,(H2,19,21)/b5-4-,15-14-,20-13+ |
| InChIKey | HKHGOSLPYWCPPZ-MKWSTVEKSA-N |
| XLogP | 1.51 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|