C9H16F2O2 — CID 142810075
(Z)-2,2-difluoro-4-propan-2-yloxyhex-4-en-3-ol (PubChem CID 142810075) has the molecular formula C9H16F2O2 and a molecular weight of 194.22 g/mol. Its IUPAC name is (Z)-2,2-difluoro-4-propan-2-yloxyhex-4-en-3-ol.
| Compound Name | (Z)-2,2-difluoro-4-propan-2-yloxyhex-4-en-3-ol |
|---|---|
| PubChem CID | 142810075 |
| Molecular Formula | C9H16F2O2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (Z)-2,2-difluoro-4-propan-2-yloxyhex-4-en-3-ol |
| SMILES | C/C=C(\OC(C)C)C(O)C(C)(F)F |
| InChI | InChI=1S/C9H16F2O2/c1-5-7(13-6(2)3)8(12)9(4,10)11/h5-6,8,12H,1-4H3/b7-5- |
| InChIKey | JTPUHUORWIEIBR-ALCCZGGFSA-N |
| XLogP | 2.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|