C12H21NO — CID 142810465
cyclopentyl-(2,2-dimethyl-3H-furan-5-yl)methanamine (PubChem CID 142810465) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is cyclopentyl-(2,2-dimethyl-3H-furan-5-yl)methanamine.
| Compound Name | cyclopentyl-(2,2-dimethyl-3H-furan-5-yl)methanamine |
|---|---|
| PubChem CID | 142810465 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | cyclopentyl-(2,2-dimethyl-3H-furan-5-yl)methanamine |
| SMILES | CC1(C)CC=C(C(N)C2CCCC2)O1 |
| InChI | InChI=1S/C12H21NO/c1-12(2)8-7-10(14-12)11(13)9-5-3-4-6-9/h7,9,11H,3-6,8,13H2,1-2H3 |
| InChIKey | QUAYYOSKULLKSZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |