C12H24O2 — CID 142810510
(Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol (PubChem CID 142810510) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol.
| Compound Name | (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol |
|---|---|
| PubChem CID | 142810510 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-6,6-dimethyl-3-propoxyhept-2-en-4-ol |
| SMILES | C/C=C(\OCCC)C(O)CC(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-6-8-14-11(7-2)10(13)9-12(3,4)5/h7,10,13H,6,8-9H2,1-5H3/b11-7- |
| InChIKey | PTNHWOIYUCAOHN-XFFZJAGNSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|