C11H20O2 — CID 101004521
(4Z)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol (PubChem CID 101004521) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4Z)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol.
| Compound Name | (4Z)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 101004521 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4Z)-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\OCC)C(O)C(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-6-8-9(13-7-2)10(12)11(3,4)5/h6,8,10,12H,1,7H2,2-5H3/b9-8- |
| InChIKey | PPKMZLGMZQPONK-HJWRWDBZSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|