C9H16O3 — CID 163195656
(2S,3R,4E,6E)-4-methoxyocta-4,6-diene-2,3-diol (PubChem CID 163195656) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2S,3R,4E,6E)-4-methoxyocta-4,6-diene-2,3-diol.
| Compound Name | (2S,3R,4E,6E)-4-methoxyocta-4,6-diene-2,3-diol |
|---|---|
| PubChem CID | 163195656 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2S,3R,4E,6E)-4-methoxyocta-4,6-diene-2,3-diol |
| SMILES | C/C=C/C=C(/OC)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C9H16O3/c1-4-5-6-8(12-3)9(11)7(2)10/h4-7,9-11H,1-3H3/b5-4+,8-6+/t7-,9+/m0/s1 |
| InChIKey | ZPDLFPKAXILTNN-LFKNHHAASA-N |
| XLogP | 0.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|