C15H28O2 — CID 11107479
(4E)-3-tert-butyl-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol (PubChem CID 11107479) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (4E)-3-tert-butyl-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol.
| Compound Name | (4E)-3-tert-butyl-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 11107479 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (4E)-3-tert-butyl-4-ethoxy-2,2-dimethylhepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(/OCC)C(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-9-11-12(17-10-2)15(16,13(3,4)5)14(6,7)8/h9,11,16H,1,10H2,2-8H3/b12-11+ |
| InChIKey | UUZATSFFKGFEQI-VAWYXSNFSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|