About californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol
californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol (PubChem CID 58278990) has the molecular formula C13H19Cf2O2-
and a molecular weight of 709.29 g/mol. Its IUPAC name is californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol.
Molecular Properties
| Compound Name | californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol |
| PubChem CID | 58278990 |
| Molecular Formula | C13H19Cf2O2- |
| Molecular Weight | 709.29 g/mol |
| Exact Mass | 705.29 |
| IUPAC Name | californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol |
| SMILES | CCC(O)COc1[c-]cc(C(C)C)cc1.[Cf].[Cf] |
| InChI | InChI=1S/C13H19O2.2Cf/c1-4-12(14)9-15-13-7-5-11(6-8-13)10(2)3;;/h5-7,10,12,14H,4,9H2,1-3H3;;/q-1;; |
| InChIKey | SGQCZZQGHYHFHR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 709.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol?
The IUPAC name of californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol (CID 58278990) is californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol.
What is the SMILES notation for californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol?
The canonical SMILES for californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol is CCC(O)COc1[c-]cc(C(C)C)cc1.[Cf].[Cf].
What is the InChIKey of californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol?
The InChIKey is SGQCZZQGHYHFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19O2.2Cf/c1-4-12(14)9-15-13-7-5-11(6-8-13)10(2)3;;/h5-7,10,12,14H,4,9H2,1-3H3;;/q-1;;.
What are the key properties of californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol?
californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol has a molecular weight of 709.29 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for californium;1-(4-propan-2-ylbenzene-6-id-1-yl)oxybutan-2-ol is sourced from PubChem (CID 58278990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).