C11H12ClN3 — CID 142810831
2-(5-chloro-2-methylphenyl)-4,5-dimethyltriazole (PubChem CID 142810831) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-4,5-dimethyltriazole.
| Compound Name | 2-(5-chloro-2-methylphenyl)-4,5-dimethyltriazole |
|---|---|
| PubChem CID | 142810831 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-4,5-dimethyltriazole |
| SMILES | Cc1ccc(Cl)cc1-n1nc(C)c(C)n1 |
| InChI | InChI=1S/C11H12ClN3/c1-7-4-5-10(12)6-11(7)15-13-8(2)9(3)14-15/h4-6H,1-3H3 |
| InChIKey | GQAMOMBYCDWYDB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |