C7H10N2 — CID 142810918
4-N-methylhexa-1,5-diene-3,4-diimine (PubChem CID 142810918) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-N-methylhexa-1,5-diene-3,4-diimine.
| Compound Name | 4-N-methylhexa-1,5-diene-3,4-diimine |
|---|---|
| PubChem CID | 142810918 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-N-methylhexa-1,5-diene-3,4-diimine |
| SMILES | [H]/N=C(\C=C)C(C=C)=NC |
| InChI | InChI=1S/C7H10N2/c1-4-6(8)7(5-2)9-3/h4-5,8H,1-2H2,3H3/b8-6+,9-7+ |
| InChIKey | INSQVBJCXPZSOV-CDJQDVQCSA-N |
| XLogP | 1.45 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|