C20H25N3O5 — CID 1428113
N-[2,5-diethoxy-4-[(2-methoxyphenyl)carbamoylamino]phenyl]acetamide (PubChem CID 1428113) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[(2-methoxyphenyl)carbamoylamino]phenyl]acetamide.
| Compound Name | N-[2,5-diethoxy-4-[(2-methoxyphenyl)carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 1428113 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[2,5-diethoxy-4-[(2-methoxyphenyl)carbamoylamino]phenyl]acetamide |
| SMILES | CCOc1cc(NC(=O)Nc2ccccc2OC)c(OCC)cc1NC(C)=O |
| InChI | InChI=1S/C20H25N3O5/c1-5-27-18-12-16(19(28-6-2)11-15(18)21-13(3)24)23-20(25)22-14-9-7-8-10-17(14)26-4/h7-12H,5-6H2,1-4H3,(H,21,24)(H2,22,23,25) |
| InChIKey | SMLXCHBAEZGDKI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |