C22H31N3O5 — CID 142811772
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-(cyclopentylmethyl)-N-hydroxy-4-oxobutanamide (PubChem CID 142811772) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-(cyclopentylmethyl)-N-hydroxy-4-oxobutanamide.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-(cyclopentylmethyl)-N-hydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 142811772 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-(cyclopentylmethyl)-N-hydroxy-4-oxobutanamide |
| SMILES | O=C(CC(CC1CCCC1)C(=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1)NO |
| InChI | InChI=1S/C22H31N3O5/c26-21(23-28)13-18(11-16-3-1-2-4-16)22(27)25-9-7-24(8-10-25)14-17-5-6-19-20(12-17)30-15-29-19/h5-6,12,16,18,28H,1-4,7-11,13-15H2,(H,23,26) |
| InChIKey | INLHPRDKVMHYFA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|