C27H24Cl2N4O2 — CID 142812571
3,5-dichloro-N-[4-[6-[(1-formylcyclopentyl)methylamino]-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 142812571) has the molecular formula C27H24Cl2N4O2 and a molecular weight of 507.42 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[6-[(1-formylcyclopentyl)methylamino]-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-[6-[(1-formylcyclopentyl)methylamino]-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142812571 |
| Molecular Formula | C27H24Cl2N4O2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 3,5-dichloro-N-[4-[6-[(1-formylcyclopentyl)methylamino]-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | O=CC1(CNc2ccc3nc(-c4ccc(NC(=O)c5cc(Cl)cc(Cl)c5)cc4)[nH]c3c2)CCCC1 |
| InChI | InChI=1S/C27H24Cl2N4O2/c28-19-11-18(12-20(29)13-19)26(35)31-21-5-3-17(4-6-21)25-32-23-8-7-22(14-24(23)33-25)30-15-27(16-34)9-1-2-10-27/h3-8,11-14,16,30H,1-2,9-10,15H2,(H,31,35)(H,32,33) |
| InChIKey | BZJXHCXHAJNUHL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|