C36H37FN4O2 — CID 142812885
N-[4-(5-benzamido-1-methylbenzimidazol-2-yl)phenyl]benzamide;2-fluoroprop-1-ene;2-methylbut-2-ene (PubChem CID 142812885) has the molecular formula C36H37FN4O2 and a molecular weight of 576.72 g/mol. Its IUPAC name is N-[4-(5-benzamido-1-methylbenzimidazol-2-yl)phenyl]benzamide;2-fluoroprop-1-ene;2-methylbut-2-ene.
| Compound Name | N-[4-(5-benzamido-1-methylbenzimidazol-2-yl)phenyl]benzamide;2-fluoroprop-1-ene;2-methylbut-2-ene |
|---|---|
| PubChem CID | 142812885 |
| Molecular Formula | C36H37FN4O2 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N-[4-(5-benzamido-1-methylbenzimidazol-2-yl)phenyl]benzamide;2-fluoroprop-1-ene;2-methylbut-2-ene |
| SMILES | C=C(C)F.CC=C(C)C.Cn1c(-c2ccc(NC(=O)c3ccccc3)cc2)nc2cc(NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C28H22N4O2.C5H10.C3H5F/c1-32-25-17-16-23(30-28(34)21-10-6-3-7-11-21)18-24(25)31-26(32)19-12-14-22(15-13-19)29-27(33)20-8-4-2-5-9-20;1-4-5(2)3;1-3(2)4/h2-18H,1H3,(H,29,33)(H,30,34);4H,1-3H3;1H2,2H3 |
| InChIKey | IJOYHKRUENATRG-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|