C26H26N4O2 — CID 58408621
4-amino-N-[4-[5-(2,2-dimethylpropanoyl)-1-methylbenzimidazol-2-yl]phenyl]benzamide (PubChem CID 58408621) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-amino-N-[4-[5-(2,2-dimethylpropanoyl)-1-methylbenzimidazol-2-yl]phenyl]benzamide.
| Compound Name | 4-amino-N-[4-[5-(2,2-dimethylpropanoyl)-1-methylbenzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58408621 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-amino-N-[4-[5-(2,2-dimethylpropanoyl)-1-methylbenzimidazol-2-yl]phenyl]benzamide |
| SMILES | Cn1c(-c2ccc(NC(=O)c3ccc(N)cc3)cc2)nc2cc(C(=O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H26N4O2/c1-26(2,3)23(31)18-9-14-22-21(15-18)29-24(30(22)4)16-7-12-20(13-8-16)28-25(32)17-5-10-19(27)11-6-17/h5-15H,27H2,1-4H3,(H,28,32) |
| InChIKey | LGLSAKSTVICQII-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|