C14H20O2 — CID 142813174
(5Z)-5-[(3Z)-3-ethylideneoxolan-2-ylidene]-4-methylhepta-1,6-dien-2-ol (PubChem CID 142813174) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (5Z)-5-[(3Z)-3-ethylideneoxolan-2-ylidene]-4-methylhepta-1,6-dien-2-ol.
| Compound Name | (5Z)-5-[(3Z)-3-ethylideneoxolan-2-ylidene]-4-methylhepta-1,6-dien-2-ol |
|---|---|
| PubChem CID | 142813174 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (5Z)-5-[(3Z)-3-ethylideneoxolan-2-ylidene]-4-methylhepta-1,6-dien-2-ol |
| SMILES | C=C/C(=C1/OCC/C1=C/C)C(C)CC(=C)O |
| InChI | InChI=1S/C14H20O2/c1-5-12-7-8-16-14(12)13(6-2)10(3)9-11(4)15/h5-6,10,15H,2,4,7-9H2,1,3H3/b12-5-,14-13- |
| InChIKey | OVKOAMZHMSJPPG-FLNLLXCPSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|