C38H58N4O5 — CID 142813995
1,2,3,4-tetrahydronaphthalen-1-yl 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 142813995) has the molecular formula C38H58N4O5 and a molecular weight of 650.91 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142813995 |
| Molecular Formula | C38H58N4O5 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)C(NC(=O)C1CCCCN1C(C)C)C(C)C)C(=O)N1CCCC1C(=O)OC1CCCc2ccccc21 |
| InChI | InChI=1S/C38H58N4O5/c1-24(2)32(40(8)37(45)34(25(3)4)39-35(43)30-18-11-12-21-41(30)26(5)6)23-27(7)36(44)42-22-14-19-31(42)38(46)47-33-20-13-16-28-15-9-10-17-29(28)33/h9-10,15,17,23-26,30-34H,11-14,16,18-22H2,1-8H3,(H,39,43)/b27-23+/t30?,31?,32-,33?,34?/m1/s1 |
| InChIKey | HBXPRPNSUYAYPC-UGZZFOPFSA-N |
| XLogP | 5.43 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|