C36H54N4O5 — CID 149115642
[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 149115642) has the molecular formula C36H54N4O5 and a molecular weight of 622.85 g/mol. Its IUPAC name is [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 149115642 |
| Molecular Formula | C36H54N4O5 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | [(1S)-1,2,3,4-tetrahydronaphthalen-1-yl] 1-[(E,4S)-2,5-dimethyl-4-[methyl-[3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]butanoyl]amino]hex-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)C(NC(=O)[C@H]1CCCCN1C)C(C)C)C(=O)N1CCCC1C(=O)O[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C36H54N4O5/c1-23(2)30(39(7)35(43)32(24(3)4)37-33(41)28-17-10-11-20-38(28)6)22-25(5)34(42)40-21-13-18-29(40)36(44)45-31-19-12-15-26-14-8-9-16-27(26)31/h8-9,14,16,22-24,28-32H,10-13,15,17-21H2,1-7H3,(H,37,41)/b25-22+/t28-,29?,30-,31+,32?/m1/s1 |
| InChIKey | QYHWDICIZALPTO-LJZSRULNSA-N |
| XLogP | 4.65 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|