C17H30FNO — CID 142816444
(6E)-1-[ethyl(methyl)amino]-6-(1-fluoroethylidene)-3-methylundeca-7,10-dien-3-ol (PubChem CID 142816444) has the molecular formula C17H30FNO and a molecular weight of 283.43 g/mol. Its IUPAC name is (6E)-1-[ethyl(methyl)amino]-6-(1-fluoroethylidene)-3-methylundeca-7,10-dien-3-ol.
| Compound Name | (6E)-1-[ethyl(methyl)amino]-6-(1-fluoroethylidene)-3-methylundeca-7,10-dien-3-ol |
|---|---|
| PubChem CID | 142816444 |
| Molecular Formula | C17H30FNO |
| Molecular Weight | 283.43 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (6E)-1-[ethyl(methyl)amino]-6-(1-fluoroethylidene)-3-methylundeca-7,10-dien-3-ol |
| SMILES | C=CCC=C/C(CCC(C)(O)CCN(C)CC)=C(\C)F |
| InChI | InChI=1S/C17H30FNO/c1-6-8-9-10-16(15(3)18)11-12-17(4,20)13-14-19(5)7-2/h6,9-10,20H,1,7-8,11-14H2,2-5H3/b10-9?,16-15- |
| InChIKey | JMUPFWVQCMYXBB-JTZQVXJSSA-N |
| XLogP | 4.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|