About osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide
osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide (PubChem CID 142816738) has the molecular formula C8H15N2OOsS3
and a molecular weight of 441.65 g/mol. Its IUPAC name is osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide.
Molecular Properties
| Compound Name | osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide |
| PubChem CID | 142816738 |
| Molecular Formula | C8H15N2OOsS3 |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide |
| SMILES | O=C(S)CC([N-]S)C1CCCN(S)C1.[Os+] |
| InChI | InChI=1S/C8H15N2OS3.Os/c11-8(12)4-7(9-13)6-2-1-3-10(14)5-6;/h6-7,13-14H,1-5H2,(H,11,12);/q-1;+1 |
| InChIKey | OVFJYUBAXZHZOB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide?
The IUPAC name of osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide (CID 142816738) is osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide.
What is the SMILES notation for osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide?
The canonical SMILES for osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide is O=C(S)CC([N-]S)C1CCCN(S)C1.[Os+].
What is the InChIKey of osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide?
The InChIKey is OVFJYUBAXZHZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2OS3.Os/c11-8(12)4-7(9-13)6-2-1-3-10(14)5-6;/h6-7,13-14H,1-5H2,(H,11,12);/q-1;+1.
What are the key properties of osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide?
osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide has a molecular weight of 441.65 g/mol, XLogP of 1.97, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for osmium(1+);[3-oxo-3-sulfanyl-1-(1-sulfanylpiperidin-3-yl)propyl]-sulfanylazanide is sourced from PubChem (CID 142816738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).