C17H28N4O — CID 142817671
acetaldehyde;6-(azepan-1-yl)-2-cyclopropyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 142817671) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is acetaldehyde;6-(azepan-1-yl)-2-cyclopropyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | acetaldehyde;6-(azepan-1-yl)-2-cyclopropyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 142817671 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | acetaldehyde;6-(azepan-1-yl)-2-cyclopropyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | CC=O.CNc1nc(C2CC2)nc(N2CCCCCC2)c1C |
| InChI | InChI=1S/C15H24N4.C2H4O/c1-11-13(16-2)17-14(12-7-8-12)18-15(11)19-9-5-3-4-6-10-19;1-2-3/h12H,3-10H2,1-2H3,(H,16,17,18);2H,1H3 |
| InChIKey | HFSIUOHXNJCODC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|