C12H22N4 — CID 91242494
6-(azetidin-1-yl)-N,2,5-trimethylpyrimidin-4-amine;ethane (PubChem CID 91242494) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 6-(azetidin-1-yl)-N,2,5-trimethylpyrimidin-4-amine;ethane.
| Compound Name | 6-(azetidin-1-yl)-N,2,5-trimethylpyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 91242494 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 6-(azetidin-1-yl)-N,2,5-trimethylpyrimidin-4-amine;ethane |
| SMILES | CC.CNc1nc(C)nc(N2CCC2)c1C |
| InChI | InChI=1S/C10H16N4.C2H6/c1-7-9(11-3)12-8(2)13-10(7)14-5-4-6-14;1-2/h4-6H2,1-3H3,(H,11,12,13);1-2H3 |
| InChIKey | IYMTVTYKLHGTFK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |