C31H34N8O — CID 142819040
3-[1-[[4-(7-amino-6-hydrazinyl-3-phenylquinoxalin-2-yl)phenyl]methyl]piperidin-4-yl]-4,5-dimethyl-1H-imidazol-2-one (PubChem CID 142819040) has the molecular formula C31H34N8O and a molecular weight of 534.67 g/mol. Its IUPAC name is 3-[1-[[4-(7-amino-6-hydrazinyl-3-phenylquinoxalin-2-yl)phenyl]methyl]piperidin-4-yl]-4,5-dimethyl-1H-imidazol-2-one.
| Compound Name | 3-[1-[[4-(7-amino-6-hydrazinyl-3-phenylquinoxalin-2-yl)phenyl]methyl]piperidin-4-yl]-4,5-dimethyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 142819040 |
| Molecular Formula | C31H34N8O |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 3-[1-[[4-(7-amino-6-hydrazinyl-3-phenylquinoxalin-2-yl)phenyl]methyl]piperidin-4-yl]-4,5-dimethyl-1H-imidazol-2-one |
| SMILES | Cc1[nH]c(=O)n(C2CCN(Cc3ccc(-c4nc5cc(N)c(NN)cc5nc4-c4ccccc4)cc3)CC2)c1C |
| InChI | InChI=1S/C31H34N8O/c1-19-20(2)39(31(40)34-19)24-12-14-38(15-13-24)18-21-8-10-23(11-9-21)30-29(22-6-4-3-5-7-22)36-28-17-26(37-33)25(32)16-27(28)35-30/h3-11,16-17,24,37H,12-15,18,32-33H2,1-2H3,(H,34,40) |
| InChIKey | DSQAQPQEMFLSCH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|