C30H34N6O2 — CID 142961602
6-[4-[[4-(4-methyl-2-oxo-5-pent-4-enyl-1H-imidazol-3-yl)piperidin-1-yl]methyl]phenyl]-5-phenyl-2H-1,2,4-triazin-3-one (PubChem CID 142961602) has the molecular formula C30H34N6O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 6-[4-[[4-(4-methyl-2-oxo-5-pent-4-enyl-1H-imidazol-3-yl)piperidin-1-yl]methyl]phenyl]-5-phenyl-2H-1,2,4-triazin-3-one.
| Compound Name | 6-[4-[[4-(4-methyl-2-oxo-5-pent-4-enyl-1H-imidazol-3-yl)piperidin-1-yl]methyl]phenyl]-5-phenyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 142961602 |
| Molecular Formula | C30H34N6O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 6-[4-[[4-(4-methyl-2-oxo-5-pent-4-enyl-1H-imidazol-3-yl)piperidin-1-yl]methyl]phenyl]-5-phenyl-2H-1,2,4-triazin-3-one |
| SMILES | C=CCCCc1[nH]c(=O)n(C2CCN(Cc3ccc(-c4n[nH]c(=O)nc4-c4ccccc4)cc3)CC2)c1C |
| InChI | InChI=1S/C30H34N6O2/c1-3-4-6-11-26-21(2)36(30(38)31-26)25-16-18-35(19-17-25)20-22-12-14-24(15-13-22)28-27(32-29(37)34-33-28)23-9-7-5-8-10-23/h3,5,7-10,12-15,25H,1,4,6,11,16-20H2,2H3,(H,31,38)(H,32,34,37) |
| InChIKey | OSCQKWWJLCIEGU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|