C30H35N3O2 — CID 142821488
4-phenyl-1-(3-phenylpropanoyl)-N'-(3-phenylpropoxy)piperidine-4-carboximidamide (PubChem CID 142821488) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 4-phenyl-1-(3-phenylpropanoyl)-N'-(3-phenylpropoxy)piperidine-4-carboximidamide.
| Compound Name | 4-phenyl-1-(3-phenylpropanoyl)-N'-(3-phenylpropoxy)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 142821488 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-phenyl-1-(3-phenylpropanoyl)-N'-(3-phenylpropoxy)piperidine-4-carboximidamide |
| SMILES | N/C(=N\OCCCc1ccccc1)C1(c2ccccc2)CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H35N3O2/c31-29(32-35-24-10-15-25-11-4-1-5-12-25)30(27-16-8-3-9-17-27)20-22-33(23-21-30)28(34)19-18-26-13-6-2-7-14-26/h1-9,11-14,16-17H,10,15,18-24H2,(H2,31,32) |
| InChIKey | IGPOHEWXYQKKPO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|