C23H26F3N3O3 — CID 137480207
[3-amino-3-(hydroxymethyl)pyrrolidin-1-yl]-[4-[(Z)-N-(3-phenylpropoxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]methanone (PubChem CID 137480207) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is [3-amino-3-(hydroxymethyl)pyrrolidin-1-yl]-[4-[(Z)-N-(3-phenylpropoxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]methanone.
| Compound Name | [3-amino-3-(hydroxymethyl)pyrrolidin-1-yl]-[4-[(Z)-N-(3-phenylpropoxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]methanone |
|---|---|
| PubChem CID | 137480207 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | [3-amino-3-(hydroxymethyl)pyrrolidin-1-yl]-[4-[(Z)-N-(3-phenylpropoxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]methanone |
| SMILES | NC1(CO)CCN(C(=O)c2ccc(/C(=N/OCCCc3ccccc3)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C23H26F3N3O3/c24-23(25,26)20(28-32-14-4-7-17-5-2-1-3-6-17)18-8-10-19(11-9-18)21(31)29-13-12-22(27,15-29)16-30/h1-3,5-6,8-11,30H,4,7,12-16,27H2/b28-20- |
| InChIKey | HEIPFUJUHNKKAQ-RRAHZORUSA-N |
| XLogP | 3.14 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|