C23H30N3O6P — CID 162533533
[(3S)-3-amino-1-[4-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]pyrrolidin-3-yl]methyl dihydrogen phosphate (PubChem CID 162533533) has the molecular formula C23H30N3O6P and a molecular weight of 475.48 g/mol. Its IUPAC name is [(3S)-3-amino-1-[4-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]pyrrolidin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [(3S)-3-amino-1-[4-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]pyrrolidin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 162533533 |
| Molecular Formula | C23H30N3O6P |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [(3S)-3-amino-1-[4-[(E)-C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]pyrrolidin-3-yl]methyl dihydrogen phosphate |
| SMILES | C/C(=N\OCCCc1ccccc1)c1ccc(C(=O)N2CC[C@@](N)(COP(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C23H30N3O6P/c1-18(25-31-15-5-8-19-6-3-2-4-7-19)20-9-11-21(12-10-20)22(27)26-14-13-23(24,16-26)17-32-33(28,29)30/h2-4,6-7,9-12H,5,8,13-17,24H2,1H3,(H2,28,29,30)/b25-18+/t23-/m0/s1 |
| InChIKey | PWSJXRMPENWESI-UPQSEYGOSA-N |
| XLogP | 2.71 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|