C24H32N3O6P — CID 152670131
[4-amino-1-[4-[C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]piperidin-4-yl]methyl dihydrogen phosphate (PubChem CID 152670131) has the molecular formula C24H32N3O6P and a molecular weight of 489.51 g/mol. Its IUPAC name is [4-amino-1-[4-[C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]piperidin-4-yl]methyl dihydrogen phosphate.
| Compound Name | [4-amino-1-[4-[C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]piperidin-4-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 152670131 |
| Molecular Formula | C24H32N3O6P |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [4-amino-1-[4-[C-methyl-N-(3-phenylpropoxy)carbonimidoyl]benzoyl]piperidin-4-yl]methyl dihydrogen phosphate |
| SMILES | CC(=NOCCCc1ccccc1)c1ccc(C(=O)N2CCC(N)(COP(=O)(O)O)CC2)cc1 |
| InChI | InChI=1S/C24H32N3O6P/c1-19(26-32-17-5-8-20-6-3-2-4-7-20)21-9-11-22(12-10-21)23(28)27-15-13-24(25,14-16-27)18-33-34(29,30)31/h2-4,6-7,9-12H,5,8,13-18,25H2,1H3,(H2,29,30,31) |
| InChIKey | ZLIWSHGREAAXEQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|