C28H36N4O2 — CID 142823119
3,6-diethyl-5-(3-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrazin-2-amine;O-(2,3-dihydro-1H-inden-2-yl)hydroxylamine (PubChem CID 142823119) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3,6-diethyl-5-(3-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrazin-2-amine;O-(2,3-dihydro-1H-inden-2-yl)hydroxylamine.
| Compound Name | 3,6-diethyl-5-(3-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrazin-2-amine;O-(2,3-dihydro-1H-inden-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 142823119 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 3,6-diethyl-5-(3-methoxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrazin-2-amine;O-(2,3-dihydro-1H-inden-2-yl)hydroxylamine |
| SMILES | CCc1nc(-c2cc3c(cc2OC)CCCC3)c(CC)nc1N.NOC1Cc2ccccc2C1 |
| InChI | InChI=1S/C19H25N3O.C9H11NO/c1-4-15-18(21-16(5-2)19(20)22-15)14-10-12-8-6-7-9-13(12)11-17(14)23-3;10-11-9-5-7-3-1-2-4-8(7)6-9/h10-11H,4-9H2,1-3H3,(H2,20,22);1-4,9H,5-6,10H2 |
| InChIKey | XPUZOGMMPCDXNY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|