C14H23NO3 — CID 142823944
ethane;5-(hydroxymethyl)-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one (PubChem CID 142823944) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is ethane;5-(hydroxymethyl)-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-(hydroxymethyl)-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142823944 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | ethane;5-(hydroxymethyl)-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C(\C=C/C)CC1NC(=O)OC1CO.CC |
| InChI | InChI=1S/C12H17NO3.C2H6/c1-3-5-9(6-4-2)7-10-11(8-14)16-12(15)13-10;1-2/h3-6,10-11,14H,1,7-8H2,2H3,(H,13,15);1-2H3/b6-4-,9-5+; |
| InChIKey | VORQYEAMBANNQJ-AFPQSWDMSA-N |
| XLogP | 2.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|