C33H52N3O11PS — CID 142824025
[(3R,4S,5R)-4-ethyl-5-methoxyoxolan-3-yl] N-[(2S,3R)-1-(4-aminophenyl)-4-[[4-(diethoxyphosphorylmethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate (PubChem CID 142824025) has the molecular formula C33H52N3O11PS and a molecular weight of 729.83 g/mol. Its IUPAC name is [(3R,4S,5R)-4-ethyl-5-methoxyoxolan-3-yl] N-[(2S,3R)-1-(4-aminophenyl)-4-[[4-(diethoxyphosphorylmethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate.
| Compound Name | [(3R,4S,5R)-4-ethyl-5-methoxyoxolan-3-yl] N-[(2S,3R)-1-(4-aminophenyl)-4-[[4-(diethoxyphosphorylmethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142824025 |
| Molecular Formula | C33H52N3O11PS |
| Molecular Weight | 729.83 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | [(3R,4S,5R)-4-ethyl-5-methoxyoxolan-3-yl] N-[(2S,3R)-1-(4-aminophenyl)-4-[[4-(diethoxyphosphorylmethoxy)phenyl]sulfonyl-(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate |
| SMILES | CCOP(=O)(COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccc(N)cc2)NC(=O)O[C@H]2CO[C@@H](OC)[C@H]2CC)cc1)OCC |
| InChI | InChI=1S/C33H52N3O11PS/c1-7-28-31(21-43-32(28)42-6)47-33(38)35-29(18-24-10-12-25(34)13-11-24)30(37)20-36(19-23(4)5)49(40,41)27-16-14-26(15-17-27)44-22-48(39,45-8-2)46-9-3/h10-17,23,28-32,37H,7-9,18-22,34H2,1-6H3,(H,35,38)/t28-,29-,30+,31-,32+/m0/s1 |
| InChIKey | CHSNMGXWTJURMB-FXSYQQGGSA-N |
| XLogP | 4.61 |
| TPSA | 185.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|