C14H23NO — CID 142824770
4-[(4Z)-4-ethenylhepta-4,6-dienoxy]piperidine (PubChem CID 142824770) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-[(4Z)-4-ethenylhepta-4,6-dienoxy]piperidine.
| Compound Name | 4-[(4Z)-4-ethenylhepta-4,6-dienoxy]piperidine |
|---|---|
| PubChem CID | 142824770 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-[(4Z)-4-ethenylhepta-4,6-dienoxy]piperidine |
| SMILES | C=C/C=C(\C=C)CCCOC1CCNCC1 |
| InChI | InChI=1S/C14H23NO/c1-3-6-13(4-2)7-5-12-16-14-8-10-15-11-9-14/h3-4,6,14-15H,1-2,5,7-12H2/b13-6+ |
| InChIKey | AJNJEUBCBWPZOQ-AWNIVKPZSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|